C28H26ClNO6S — CID 2019019
(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 2019019) has the molecular formula C28H26ClNO6S and a molecular weight of 540.04 g/mol. Its IUPAC name is (3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | (3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 2019019 |
| Molecular Formula | C28H26ClNO6S |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | (3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)Oc1cc2oc(=O)c(Cc3ccccc3)c(C)c2cc1Cl |
| InChI | InChI=1S/C28H26ClNO6S/c1-4-24(30-37(33,34)20-12-10-17(2)11-13-20)28(32)36-26-16-25-21(15-23(26)29)18(3)22(27(31)35-25)14-19-8-6-5-7-9-19/h5-13,15-16,24,30H,4,14H2,1-3H3/t24-/m1/s1 |
| InChIKey | VQDOQCDYFHPTKK-XMMPIXPASA-N |
| XLogP | 5.32 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|