C31H24ClNO6S — CID 98130480
(6-chloro-2-oxo-4-phenylchromen-7-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 98130480) has the molecular formula C31H24ClNO6S and a molecular weight of 574.05 g/mol. Its IUPAC name is (6-chloro-2-oxo-4-phenylchromen-7-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | (6-chloro-2-oxo-4-phenylchromen-7-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 98130480 |
| Molecular Formula | C31H24ClNO6S |
| Molecular Weight | 574.05 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | (6-chloro-2-oxo-4-phenylchromen-7-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)Oc2cc3oc(=O)cc(-c4ccccc4)c3cc2Cl)cc1 |
| InChI | InChI=1S/C31H24ClNO6S/c1-20-12-14-23(15-13-20)40(36,37)33-27(16-21-8-4-2-5-9-21)31(35)39-29-19-28-25(17-26(29)32)24(18-30(34)38-28)22-10-6-3-7-11-22/h2-15,17-19,27,33H,16H2,1H3/t27-/m0/s1 |
| InChIKey | RZKUGDCVTDFEDU-MHZLTWQESA-N |
| XLogP | 5.92 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.05 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|