C24H26ClNO6S — CID 4908531
(6-chloro-2-oxo-4-propylchromen-7-yl) 3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 4908531) has the molecular formula C24H26ClNO6S and a molecular weight of 491.99 g/mol. Its IUPAC name is (6-chloro-2-oxo-4-propylchromen-7-yl) 3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | (6-chloro-2-oxo-4-propylchromen-7-yl) 3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 4908531 |
| Molecular Formula | C24H26ClNO6S |
| Molecular Weight | 491.99 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (6-chloro-2-oxo-4-propylchromen-7-yl) 3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CCCc1cc(=O)oc2cc(OC(=O)C(NS(=O)(=O)c3ccc(C)cc3)C(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C24H26ClNO6S/c1-5-6-16-11-22(27)31-20-13-21(19(25)12-18(16)20)32-24(28)23(14(2)3)26-33(29,30)17-9-7-15(4)8-10-17/h7-14,23,26H,5-6H2,1-4H3 |
| InChIKey | XDJVMSHXYZMCNI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|