C25H28ClNO6S — CID 3838621
(6-chloro-2-oxo-4-propylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 3838621) has the molecular formula C25H28ClNO6S and a molecular weight of 506.02 g/mol. Its IUPAC name is (6-chloro-2-oxo-4-propylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | (6-chloro-2-oxo-4-propylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3838621 |
| Molecular Formula | C25H28ClNO6S |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | (6-chloro-2-oxo-4-propylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | CCCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)Oc1cc2oc(=O)cc(CCC)c2cc1Cl |
| InChI | InChI=1S/C25H28ClNO6S/c1-4-6-8-21(27-34(30,31)18-11-9-16(3)10-12-18)25(29)33-23-15-22-19(14-20(23)26)17(7-5-2)13-24(28)32-22/h9-15,21,27H,4-8H2,1-3H3 |
| InChIKey | MGQJCLHTWJNDKA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|