C15H15ClO5 — CID 938033
(2R)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxypropanoic acid (PubChem CID 938033) has the molecular formula C15H15ClO5 and a molecular weight of 310.73 g/mol. Its IUPAC name is (2R)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxypropanoic acid.
| Compound Name | (2R)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 938033 |
| Molecular Formula | C15H15ClO5 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (2R)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxypropanoic acid |
| SMILES | CCCc1cc(=O)oc2cc(O[C@H](C)C(=O)O)c(Cl)cc12 |
| InChI | InChI=1S/C15H15ClO5/c1-3-4-9-5-14(17)21-12-7-13(11(16)6-10(9)12)20-8(2)15(18)19/h5-8H,3-4H2,1-2H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | MGULNSAVHAUNKV-MRVPVSSYSA-N |
| XLogP | 3.25 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|