C22H29ClN2O5 — CID 29034234
(2S)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxy-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 29034234) has the molecular formula C22H29ClN2O5 and a molecular weight of 436.94 g/mol. Its IUPAC name is (2S)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxy-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | (2S)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxy-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 29034234 |
| Molecular Formula | C22H29ClN2O5 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (2S)-2-(6-chloro-2-oxo-4-propylchromen-7-yl)oxy-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | CCCc1cc(=O)oc2cc(O[C@@H](C)C(=O)NCCCN3CCOCC3)c(Cl)cc12 |
| InChI | InChI=1S/C22H29ClN2O5/c1-3-5-16-12-21(26)30-19-14-20(18(23)13-17(16)19)29-15(2)22(27)24-6-4-7-25-8-10-28-11-9-25/h12-15H,3-11H2,1-2H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | POQYQSZIWNVOGW-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|