C19H30ClN3O2 — CID 52515244
(2S)-2-(2-chloro-5-methylphenoxy)-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide (PubChem CID 52515244) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is (2S)-2-(2-chloro-5-methylphenoxy)-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide.
| Compound Name | (2S)-2-(2-chloro-5-methylphenoxy)-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide |
|---|---|
| PubChem CID | 52515244 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2S)-2-(2-chloro-5-methylphenoxy)-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide |
| SMILES | Cc1ccc(Cl)c(O[C@@H](C)C(=O)NCCCCN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H30ClN3O2/c1-15-6-7-17(20)18(14-15)25-16(2)19(24)21-8-4-5-9-23-12-10-22(3)11-13-23/h6-7,14,16H,4-5,8-13H2,1-3H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | GCFOXPJTWLRGDR-INIZCTEOSA-N |
| XLogP | 2.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|