C17H26ClN3O2 — CID 94040489
(2R)-2-(2-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 94040489) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | (2R)-2-(2-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 94040489 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-2-(2-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | C[C@@H](Oc1ccccc1Cl)C(=O)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-14(23-16-7-4-3-6-15(16)18)17(22)19-8-5-9-21-12-10-20(2)11-13-21/h3-4,6-7,14H,5,8-13H2,1-2H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | FYJRORWADOZLRQ-CQSZACIVSA-N |
| XLogP | 1.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|