C20H19ClN2O4 — CID 4975664
2-(6-chloro-4-ethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 4975664) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-(6-chloro-4-ethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 2-(6-chloro-4-ethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 4975664 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-(6-chloro-4-ethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CCc1cc(=O)oc2cc(OC(C)C(=O)NCc3ccncc3)c(Cl)cc12 |
| InChI | InChI=1S/C20H19ClN2O4/c1-3-14-8-19(24)27-17-10-18(16(21)9-15(14)17)26-12(2)20(25)23-11-13-4-6-22-7-5-13/h4-10,12H,3,11H2,1-2H3,(H,23,25) |
| InChIKey | UQYIUZMXOKKKTF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|