C20H20N2O4 — CID 4905099
2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 4905099) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 4905099 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(C)C(=O)NCc3ccncc3)ccc12 |
| InChI | InChI=1S/C20H20N2O4/c1-12-10-18(23)26-19-13(2)17(5-4-16(12)19)25-14(3)20(24)22-11-15-6-8-21-9-7-15/h4-10,14H,11H2,1-3H3,(H,22,24) |
| InChIKey | NZYIIEHMQKEJHW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|