C22H23NO5 — CID 40634128
(2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2R)-2-hydroxy-2-phenylethyl]propanamide (PubChem CID 40634128) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2R)-2-hydroxy-2-phenylethyl]propanamide.
| Compound Name | (2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2R)-2-hydroxy-2-phenylethyl]propanamide |
|---|---|
| PubChem CID | 40634128 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2R)-2-hydroxy-2-phenylethyl]propanamide |
| SMILES | Cc1cc(=O)oc2c(C)c(O[C@@H](C)C(=O)NC[C@H](O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C22H23NO5/c1-13-11-20(25)28-21-14(2)19(10-9-17(13)21)27-15(3)22(26)23-12-18(24)16-7-5-4-6-8-16/h4-11,15,18,24H,12H2,1-3H3,(H,23,26)/t15-,18-/m0/s1 |
| InChIKey | NWLLMIPUEIJPHA-YJBOKZPZSA-N |
| XLogP | 3.03 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|