C24H27NO5 — CID 4911162
N-(2-hydroxy-2-phenylethyl)-2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanamide (PubChem CID 4911162) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanamide |
|---|---|
| PubChem CID | 4911162 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanamide |
| SMILES | CCCc1cc(=O)oc2cc(C)cc(OC(C)C(=O)NCC(O)c3ccccc3)c12 |
| InChI | InChI=1S/C24H27NO5/c1-4-8-18-13-22(27)30-21-12-15(2)11-20(23(18)21)29-16(3)24(28)25-14-19(26)17-9-6-5-7-10-17/h5-7,9-13,16,19,26H,4,8,14H2,1-3H3,(H,25,28) |
| InChIKey | BAHSAQKVEPVYOL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|