C22H23NO4 — CID 4909677
2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2-phenylpropyl)acetamide (PubChem CID 4909677) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2-phenylpropyl)acetamide.
| Compound Name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 4909677 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2-phenylpropyl)acetamide |
| SMILES | Cc1cc(OCC(=O)NCC(C)c2ccccc2)c2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23NO4/c1-14-9-18(22-15(2)11-21(25)27-19(22)10-14)26-13-20(24)23-12-16(3)17-7-5-4-6-8-17/h4-11,16H,12-13H2,1-3H3,(H,23,24) |
| InChIKey | IQLLLXIIDRWPEA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|