C19H21N3O4 — CID 4905395
2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(3-imidazol-1-ylpropyl)acetamide (PubChem CID 4905395) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(3-imidazol-1-ylpropyl)acetamide.
| Compound Name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(3-imidazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 4905395 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(3-imidazol-1-ylpropyl)acetamide |
| SMILES | Cc1cc(OCC(=O)NCCCn2ccnc2)c2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H21N3O4/c1-13-8-15(19-14(2)10-18(24)26-16(19)9-13)25-11-17(23)21-4-3-6-22-7-5-20-12-22/h5,7-10,12H,3-4,6,11H2,1-2H3,(H,21,23) |
| InChIKey | QCPWORYWKZWDAY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|