C21H19NO5 — CID 4901462
N-(4-acetylphenyl)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetamide (PubChem CID 4901462) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetamide.
| Compound Name | N-(4-acetylphenyl)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetamide |
|---|---|
| PubChem CID | 4901462 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(4-acetylphenyl)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetamide |
| SMILES | CC(=O)c1ccc(NC(=O)COc2cc(C)cc3oc(=O)cc(C)c23)cc1 |
| InChI | InChI=1S/C21H19NO5/c1-12-8-17(21-13(2)10-20(25)27-18(21)9-12)26-11-19(24)22-16-6-4-15(5-7-16)14(3)23/h4-10H,11H2,1-3H3,(H,22,24) |
| InChIKey | DLEOMZOHNGHHOX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|