C25H20ClNO4 — CID 1300109
N-[(4-chlorophenyl)methyl]-2-(7-methyl-2-oxo-4-phenylchromen-5-yl)oxyacetamide (PubChem CID 1300109) has the molecular formula C25H20ClNO4 and a molecular weight of 433.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(7-methyl-2-oxo-4-phenylchromen-5-yl)oxyacetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(7-methyl-2-oxo-4-phenylchromen-5-yl)oxyacetamide |
|---|---|
| PubChem CID | 1300109 |
| Molecular Formula | C25H20ClNO4 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(7-methyl-2-oxo-4-phenylchromen-5-yl)oxyacetamide |
| SMILES | Cc1cc(OCC(=O)NCc2ccc(Cl)cc2)c2c(-c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H20ClNO4/c1-16-11-21(30-15-23(28)27-14-17-7-9-19(26)10-8-17)25-20(18-5-3-2-4-6-18)13-24(29)31-22(25)12-16/h2-13H,14-15H2,1H3,(H,27,28) |
| InChIKey | QVUZRJXCWJCPOV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|