C20H18ClNO5 — CID 4911631
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide (PubChem CID 4911631) has the molecular formula C20H18ClNO5 and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 4911631 |
| Molecular Formula | C20H18ClNO5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)NCCCO |
| InChI | InChI=1S/C20H18ClNO5/c21-16-9-15-14(13-5-2-1-3-6-13)10-20(25)27-17(15)11-18(16)26-12-19(24)22-7-4-8-23/h1-3,5-6,9-11,23H,4,7-8,12H2,(H,22,24) |
| InChIKey | NEPBWKZTKFVKES-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|