C22H15ClN2O5S — CID 24523373
2-[[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]thiophene-3-carboxamide (PubChem CID 24523373) has the molecular formula C22H15ClN2O5S and a molecular weight of 454.89 g/mol. Its IUPAC name is 2-[[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24523373 |
| Molecular Formula | C22H15ClN2O5S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 2-[[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl |
| InChI | InChI=1S/C22H15ClN2O5S/c23-16-8-15-14(12-4-2-1-3-5-12)9-20(27)30-17(15)10-18(16)29-11-19(26)25-22-13(21(24)28)6-7-31-22/h1-10H,11H2,(H2,24,28)(H,25,26) |
| InChIKey | FXXOHQZHZAHAKX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|