C22H14Cl2N2O4 — CID 24520428
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 24520428) has the molecular formula C22H14Cl2N2O4 and a molecular weight of 441.27 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 24520428 |
| Molecular Formula | C22H14Cl2N2O4 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)Nc1cccnc1Cl |
| InChI | InChI=1S/C22H14Cl2N2O4/c23-16-9-15-14(13-5-2-1-3-6-13)10-21(28)30-18(15)11-19(16)29-12-20(27)26-17-7-4-8-25-22(17)24/h1-11H,12H2,(H,26,27) |
| InChIKey | CZCRKSQLGPQIFV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|