C23H20ClNO6 — CID 41087669
(3R)-1-[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]piperidine-3-carboxylic acid (PubChem CID 41087669) has the molecular formula C23H20ClNO6 and a molecular weight of 441.87 g/mol. Its IUPAC name is (3R)-1-[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 41087669 |
| Molecular Formula | C23H20ClNO6 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | (3R)-1-[2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxyacetyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)COc2cc3oc(=O)cc(-c4ccccc4)c3cc2Cl)C1 |
| InChI | InChI=1S/C23H20ClNO6/c24-18-9-17-16(14-5-2-1-3-6-14)10-22(27)31-19(17)11-20(18)30-13-21(26)25-8-4-7-15(12-25)23(28)29/h1-3,5-6,9-11,15H,4,7-8,12-13H2,(H,28,29)/t15-/m1/s1 |
| InChIKey | JFCAPVQCHRVKMT-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|