C25H26ClNO4 — CID 146342734
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(cyclohexylmethyl)propanamide (PubChem CID 146342734) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(cyclohexylmethyl)propanamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 146342734 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(cyclohexylmethyl)propanamide |
| SMILES | CC(Oc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C25H26ClNO4/c1-16(25(29)27-15-17-8-4-2-5-9-17)30-23-14-22-20(12-21(23)26)19(13-24(28)31-22)18-10-6-3-7-11-18/h3,6-7,10-14,16-17H,2,4-5,8-9,15H2,1H3,(H,27,29) |
| InChIKey | WTMPMOWRXJWRTI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|