C20H15ClF3NO4 — CID 24520440
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 24520440) has the molecular formula C20H15ClF3NO4 and a molecular weight of 425.79 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 24520440 |
| Molecular Formula | C20H15ClF3NO4 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(Oc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C20H15ClF3NO4/c1-11(19(27)25-10-20(22,23)24)28-17-9-16-14(7-15(17)21)13(8-18(26)29-16)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,25,27) |
| InChIKey | QOWZCCZSQAVNLY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|