C27H24ClNO5 — CID 146306514
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-[4-(3-hydroxypropyl)phenyl]propanamide (PubChem CID 146306514) has the molecular formula C27H24ClNO5 and a molecular weight of 477.94 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-[4-(3-hydroxypropyl)phenyl]propanamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-[4-(3-hydroxypropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 146306514 |
| Molecular Formula | C27H24ClNO5 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-[4-(3-hydroxypropyl)phenyl]propanamide |
| SMILES | CC(Oc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)C(=O)Nc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C27H24ClNO5/c1-17(27(32)29-20-11-9-18(10-12-20)6-5-13-30)33-25-16-24-22(14-23(25)28)21(15-26(31)34-24)19-7-3-2-4-8-19/h2-4,7-12,14-17,30H,5-6,13H2,1H3,(H,29,32) |
| InChIKey | TZACYEQPMBIZBO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|