C28H25ClN2O4 — CID 2185652
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 2185652) has the molecular formula C28H25ClN2O4 and a molecular weight of 488.97 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2185652 |
| Molecular Formula | C28H25ClN2O4 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H25ClN2O4/c29-24-15-23-22(19-7-3-1-4-8-19)16-28(33)35-25(23)17-26(24)34-18-27(32)30-20-9-11-21(12-10-20)31-13-5-2-6-14-31/h1,3-4,7-12,15-17H,2,5-6,13-14,18H2,(H,30,32) |
| InChIKey | AHVBXWZXVMATRE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|