C22H13ClN2O4S — CID 24523378
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-cyanothiophen-2-yl)acetamide (PubChem CID 24523378) has the molecular formula C22H13ClN2O4S and a molecular weight of 436.88 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-cyanothiophen-2-yl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-cyanothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 24523378 |
| Molecular Formula | C22H13ClN2O4S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(3-cyanothiophen-2-yl)acetamide |
| SMILES | N#Cc1ccsc1NC(=O)COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl |
| InChI | InChI=1S/C22H13ClN2O4S/c23-17-8-16-15(13-4-2-1-3-5-13)9-21(27)29-18(16)10-19(17)28-12-20(26)25-22-14(11-24)6-7-30-22/h1-10H,12H2,(H,25,26) |
| InChIKey | IPWMEQQDGWUXCW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|