C15H9Cl3N2O2 — CID 4511857
N-(2-cyanophenyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 4511857) has the molecular formula C15H9Cl3N2O2 and a molecular weight of 355.61 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4511857 |
| Molecular Formula | C15H9Cl3N2O2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl3N2O2/c16-10-5-12(18)14(6-11(10)17)22-8-15(21)20-13-4-2-1-3-9(13)7-19/h1-6H,8H2,(H,20,21) |
| InChIKey | GCFRQDKNQYIYEF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|