About methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate
methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate (PubChem CID 55812005) has the molecular formula C14H10Cl3NO4S
and a molecular weight of 394.66 g/mol. Its IUPAC name is methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate |
| PubChem CID | 55812005 |
| Molecular Formula | C14H10Cl3NO4S |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3NO4S/c1-21-14(20)7-2-3-23-13(7)18-12(19)6-22-11-5-9(16)8(15)4-10(11)17/h2-5H,6H2,1H3,(H,18,19) |
| InChIKey | YLNRERKIOWIILL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate?
The IUPAC name of methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate (CID 55812005) is methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate.
What is the SMILES notation for methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate?
The canonical SMILES for methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate is COC(=O)c1ccsc1NC(=O)COc1cc(Cl)c(Cl)cc1Cl.
What is the InChIKey of methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate?
The InChIKey is YLNRERKIOWIILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl3NO4S/c1-21-14(20)7-2-3-23-13(7)18-12(19)6-22-11-5-9(16)8(15)4-10(11)17/h2-5H,6H2,1H3,(H,18,19).
What are the key properties of methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate?
methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate has a molecular weight of 394.66 g/mol, XLogP of 4.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiophene-3-carboxylate is sourced from PubChem (CID 55812005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).