C16H11Cl4NO4 — CID 55320888
methyl 3-chloro-4-[2-oxo-2-(2,4,5-trichloroanilino)ethoxy]benzoate (PubChem CID 55320888) has the molecular formula C16H11Cl4NO4 and a molecular weight of 423.08 g/mol. Its IUPAC name is methyl 3-chloro-4-[2-oxo-2-(2,4,5-trichloroanilino)ethoxy]benzoate.
| Compound Name | methyl 3-chloro-4-[2-oxo-2-(2,4,5-trichloroanilino)ethoxy]benzoate |
|---|---|
| PubChem CID | 55320888 |
| Molecular Formula | C16H11Cl4NO4 |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | methyl 3-chloro-4-[2-oxo-2-(2,4,5-trichloroanilino)ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl4NO4/c1-24-16(23)8-2-3-14(12(20)4-8)25-7-15(22)21-13-6-10(18)9(17)5-11(13)19/h2-6H,7H2,1H3,(H,21,22) |
| InChIKey | VHLOEVKHDJBGQE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|