C18H17Cl3N2O4 — CID 55893966
4-methoxy-N,N-dimethyl-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]benzamide (PubChem CID 55893966) has the molecular formula C18H17Cl3N2O4 and a molecular weight of 431.70 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]benzamide.
| Compound Name | 4-methoxy-N,N-dimethyl-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55893966 |
| Molecular Formula | C18H17Cl3N2O4 |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]benzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1NC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl3N2O4/c1-23(2)18(25)10-4-5-15(26-3)14(6-10)22-17(24)9-27-16-8-12(20)11(19)7-13(16)21/h4-8H,9H2,1-3H3,(H,22,24) |
| InChIKey | SJHCXQMNKBRDCH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|