C17H16ClIN2O3 — CID 55670012
4-chloro-3-[[2-(4-iodophenoxy)acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 55670012) has the molecular formula C17H16ClIN2O3 and a molecular weight of 458.68 g/mol. Its IUPAC name is 4-chloro-3-[[2-(4-iodophenoxy)acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-3-[[2-(4-iodophenoxy)acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55670012 |
| Molecular Formula | C17H16ClIN2O3 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 4-chloro-3-[[2-(4-iodophenoxy)acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(NC(=O)COc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C17H16ClIN2O3/c1-21(2)17(23)11-3-8-14(18)15(9-11)20-16(22)10-24-13-6-4-12(19)5-7-13/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | KUOVAEBQNALOEO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|