C12H16ClN3O2 — CID 43697266
4-chloro-N,N-dimethyl-3-[[2-(methylamino)acetyl]amino]benzamide (PubChem CID 43697266) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-[[2-(methylamino)acetyl]amino]benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-[[2-(methylamino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 43697266 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-[[2-(methylamino)acetyl]amino]benzamide |
| SMILES | CNCC(=O)Nc1cc(C(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C12H16ClN3O2/c1-14-7-11(17)15-10-6-8(4-5-9(10)13)12(18)16(2)3/h4-6,14H,7H2,1-3H3,(H,15,17) |
| InChIKey | KVAUDFUUPICZOA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |