C13H15ClN2O2 — CID 112727335
3-(but-2-enoylamino)-4-chloro-N,N-dimethylbenzamide (PubChem CID 112727335) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 3-(but-2-enoylamino)-4-chloro-N,N-dimethylbenzamide.
| Compound Name | 3-(but-2-enoylamino)-4-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 112727335 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-(but-2-enoylamino)-4-chloro-N,N-dimethylbenzamide |
| SMILES | CC=CC(=O)Nc1cc(C(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O2/c1-4-5-12(17)15-11-8-9(6-7-10(11)14)13(18)16(2)3/h4-8H,1-3H3,(H,15,17) |
| InChIKey | YHRXWFIGKLGMCO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|