C14H18BrClN2O2 — CID 43696142
3-[(2-bromo-3-methylbutanoyl)amino]-4-chloro-N,N-dimethylbenzamide (PubChem CID 43696142) has the molecular formula C14H18BrClN2O2 and a molecular weight of 361.67 g/mol. Its IUPAC name is 3-[(2-bromo-3-methylbutanoyl)amino]-4-chloro-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-bromo-3-methylbutanoyl)amino]-4-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 43696142 |
| Molecular Formula | C14H18BrClN2O2 |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 3-[(2-bromo-3-methylbutanoyl)amino]-4-chloro-N,N-dimethylbenzamide |
| SMILES | CC(C)C(Br)C(=O)Nc1cc(C(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C14H18BrClN2O2/c1-8(2)12(15)13(19)17-11-7-9(5-6-10(11)16)14(20)18(3)4/h5-8,12H,1-4H3,(H,17,19) |
| InChIKey | LRMRGJLYCJMWKX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|