C20H20ClN3O2 — CID 55603749
4-chloro-N,N-dimethyl-3-[[2-(2-methylindol-1-yl)acetyl]amino]benzamide (PubChem CID 55603749) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-[[2-(2-methylindol-1-yl)acetyl]amino]benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-[[2-(2-methylindol-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55603749 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-[[2-(2-methylindol-1-yl)acetyl]amino]benzamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)Nc1cc(C(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C20H20ClN3O2/c1-13-10-14-6-4-5-7-18(14)24(13)12-19(25)22-17-11-15(8-9-16(17)21)20(26)23(2)3/h4-11H,12H2,1-3H3,(H,22,25) |
| InChIKey | FLZKLMVUXNEGMK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |