C26H25N3O4 — CID 26705081
N-[2,5-dimethoxy-4-[[2-(2-methylindol-1-yl)acetyl]amino]phenyl]benzamide (PubChem CID 26705081) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[[2-(2-methylindol-1-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-[[2-(2-methylindol-1-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 26705081 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[2,5-dimethoxy-4-[[2-(2-methylindol-1-yl)acetyl]amino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)Cn1c(C)cc2ccccc21 |
| InChI | InChI=1S/C26H25N3O4/c1-17-13-19-11-7-8-12-22(19)29(17)16-25(30)27-20-14-24(33-3)21(15-23(20)32-2)28-26(31)18-9-5-4-6-10-18/h4-15H,16H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | KPCAMPDJJNUJFQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |