C21H23N3O5 — CID 9374401
N-[2,5-dimethoxy-4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]phenyl]benzamide (PubChem CID 9374401) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 9374401 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2,5-dimethoxy-4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CN1CCCC1=O |
| InChI | InChI=1S/C21H23N3O5/c1-28-17-12-16(23-21(27)14-7-4-3-5-8-14)18(29-2)11-15(17)22-19(25)13-24-10-6-9-20(24)26/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | GADQKBHLAYXPPI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |