About methanamine;methyl 3-chloro-4-ethoxybenzoate
methanamine;methyl 3-chloro-4-ethoxybenzoate (PubChem CID 23512246) has the molecular formula C11H16ClNO3
and a molecular weight of 245.71 g/mol. Its IUPAC name is methanamine;methyl 3-chloro-4-ethoxybenzoate.
Molecular Properties
| Compound Name | methanamine;methyl 3-chloro-4-ethoxybenzoate |
| PubChem CID | 23512246 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | methanamine;methyl 3-chloro-4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OC)cc1Cl.CN |
| InChI | InChI=1S/C10H11ClO3.CH5N/c1-3-14-9-5-4-7(6-8(9)11)10(12)13-2;1-2/h4-6H,3H2,1-2H3;2H2,1H3 |
| InChIKey | LFMUOMYPKANIDD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanamine;methyl 3-chloro-4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;methyl 3-chloro-4-ethoxybenzoate?
The IUPAC name of methanamine;methyl 3-chloro-4-ethoxybenzoate (CID 23512246) is methanamine;methyl 3-chloro-4-ethoxybenzoate.
What is the SMILES notation for methanamine;methyl 3-chloro-4-ethoxybenzoate?
The canonical SMILES for methanamine;methyl 3-chloro-4-ethoxybenzoate is CCOc1ccc(C(=O)OC)cc1Cl.CN.
What is the InChIKey of methanamine;methyl 3-chloro-4-ethoxybenzoate?
The InChIKey is LFMUOMYPKANIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3.CH5N/c1-3-14-9-5-4-7(6-8(9)11)10(12)13-2;1-2/h4-6H,3H2,1-2H3;2H2,1H3.
What are the key properties of methanamine;methyl 3-chloro-4-ethoxybenzoate?
methanamine;methyl 3-chloro-4-ethoxybenzoate has a molecular weight of 245.71 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;methyl 3-chloro-4-ethoxybenzoate is sourced from PubChem (CID 23512246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).