C11H11ClO3 — CID 82287879
1-(3-chloro-4-ethoxyphenyl)propane-1,2-dione (PubChem CID 82287879) has the molecular formula C11H11ClO3 and a molecular weight of 226.66 g/mol. Its IUPAC name is 1-(3-chloro-4-ethoxyphenyl)propane-1,2-dione.
| Compound Name | 1-(3-chloro-4-ethoxyphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 82287879 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-(3-chloro-4-ethoxyphenyl)propane-1,2-dione |
| SMILES | CCOc1ccc(C(=O)C(C)=O)cc1Cl |
| InChI | InChI=1S/C11H11ClO3/c1-3-15-10-5-4-8(6-9(10)12)11(14)7(2)13/h4-6H,3H2,1-2H3 |
| InChIKey | GFMGHINBGVWDGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|