C20H22O6 — CID 126457801
1,2-bis(3-ethoxy-4-methoxyphenyl)ethane-1,2-dione (PubChem CID 126457801) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1,2-bis(3-ethoxy-4-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(3-ethoxy-4-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 126457801 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1,2-bis(3-ethoxy-4-methoxyphenyl)ethane-1,2-dione |
| SMILES | CCOc1cc(C(=O)C(=O)c2ccc(OC)c(OCC)c2)ccc1OC |
| InChI | InChI=1S/C20H22O6/c1-5-25-17-11-13(7-9-15(17)23-3)19(21)20(22)14-8-10-16(24-4)18(12-14)26-6-2/h7-12H,5-6H2,1-4H3 |
| InChIKey | WTDSIHIDRQKUHD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|