C24H28O6 — CID 85391342
1,4-bis(4-ethoxy-3-methoxyphenyl)-2,3-dimethylbut-2-ene-1,4-dione (PubChem CID 85391342) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 1,4-bis(4-ethoxy-3-methoxyphenyl)-2,3-dimethylbut-2-ene-1,4-dione.
| Compound Name | 1,4-bis(4-ethoxy-3-methoxyphenyl)-2,3-dimethylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 85391342 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1,4-bis(4-ethoxy-3-methoxyphenyl)-2,3-dimethylbut-2-ene-1,4-dione |
| SMILES | CCOc1ccc(C(=O)C(C)=C(C)C(=O)c2ccc(OCC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H28O6/c1-7-29-19-11-9-17(13-21(19)27-5)23(25)15(3)16(4)24(26)18-10-12-20(30-8-2)22(14-18)28-6/h9-14H,7-8H2,1-6H3 |
| InChIKey | MYIIDDDFXZDLKF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|