C14H12Cl3NO2S — CID 7918061
N-[(1S)-1-thiophen-2-ylethyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7918061) has the molecular formula C14H12Cl3NO2S and a molecular weight of 364.68 g/mol. Its IUPAC name is N-[(1S)-1-thiophen-2-ylethyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(1S)-1-thiophen-2-ylethyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7918061 |
| Molecular Formula | C14H12Cl3NO2S |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N-[(1S)-1-thiophen-2-ylethyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | C[C@H](NC(=O)COc1cc(Cl)c(Cl)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H12Cl3NO2S/c1-8(13-3-2-4-21-13)18-14(19)7-20-12-6-10(16)9(15)5-11(12)17/h2-6,8H,7H2,1H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | DHRYOQDNKQWYAI-QMMMGPOBSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|