C21H20N2O3S — CID 40616574
2-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethoxy]-N-phenylbenzamide (PubChem CID 40616574) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethoxy]-N-phenylbenzamide.
| Compound Name | 2-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 40616574 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethoxy]-N-phenylbenzamide |
| SMILES | C[C@@H](NC(=O)COc1ccccc1C(=O)Nc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H20N2O3S/c1-15(19-12-7-13-27-19)22-20(24)14-26-18-11-6-5-10-17(18)21(25)23-16-8-3-2-4-9-16/h2-13,15H,14H2,1H3,(H,22,24)(H,23,25)/t15-/m1/s1 |
| InChIKey | XSYZGEQRFNFGBY-OAHLLOKOSA-N |
| XLogP | 4.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |