C24H22N2O5 — CID 7981027
2-[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 7981027) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 2-[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 7981027 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | C[C@@H](NC(=O)COc1ccccc1C(=O)Nc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H22N2O5/c1-16(17-11-12-21-22(13-17)31-15-30-21)25-23(27)14-29-20-10-6-5-9-19(20)24(28)26-18-7-3-2-4-8-18/h2-13,16H,14-15H2,1H3,(H,25,27)(H,26,28)/t16-/m1/s1 |
| InChIKey | WTVWHNLDCQBZOC-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |