C17H15ClN2O2S — CID 8716298
2-(5-chloroquinolin-8-yl)oxy-N-[(1S)-1-thiophen-2-ylethyl]acetamide (PubChem CID 8716298) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)oxy-N-[(1S)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(5-chloroquinolin-8-yl)oxy-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 8716298 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)oxy-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)COc1ccc(Cl)c2cccnc12)c1cccs1 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-11(15-5-3-9-23-15)20-16(21)10-22-14-7-6-13(18)12-4-2-8-19-17(12)14/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | RSSBKAYQAWGPGB-NSHDSACASA-N |
| XLogP | 4.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |