C17H19ClN2O4 — CID 119363599
(2R)-2-[[2-(5-chloroquinolin-8-yl)oxyacetyl]amino]-4-methylpentanoic acid (PubChem CID 119363599) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is (2R)-2-[[2-(5-chloroquinolin-8-yl)oxyacetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-(5-chloroquinolin-8-yl)oxyacetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119363599 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (2R)-2-[[2-(5-chloroquinolin-8-yl)oxyacetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)COc1ccc(Cl)c2cccnc12)C(=O)O |
| InChI | InChI=1S/C17H19ClN2O4/c1-10(2)8-13(17(22)23)20-15(21)9-24-14-6-5-12(18)11-4-3-7-19-16(11)14/h3-7,10,13H,8-9H2,1-2H3,(H,20,21)(H,22,23)/t13-/m1/s1 |
| InChIKey | OVHSFTAYSCGDKT-CYBMUJFWSA-N |
| XLogP | 2.88 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |