C26H23NO6S — CID 3489508
(4,7-dimethyl-2-oxochromen-5-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate (PubChem CID 3489508) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is (4,7-dimethyl-2-oxochromen-5-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | (4,7-dimethyl-2-oxochromen-5-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3489508 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (4,7-dimethyl-2-oxochromen-5-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)Oc2cc(C)cc3oc(=O)cc(C)c23)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO6S/c1-16-9-11-20(12-10-16)34(30,31)27-25(19-7-5-4-6-8-19)26(29)33-22-14-17(2)13-21-24(22)18(3)15-23(28)32-21/h4-15,25,27H,1-3H3 |
| InChIKey | BAIDXACTOJCIDS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|