C29H23NO7S — CID 3772416
(8-methoxy-6-oxobenzo[c]chromen-3-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate (PubChem CID 3772416) has the molecular formula C29H23NO7S and a molecular weight of 529.57 g/mol. Its IUPAC name is (8-methoxy-6-oxobenzo[c]chromen-3-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | (8-methoxy-6-oxobenzo[c]chromen-3-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3772416 |
| Molecular Formula | C29H23NO7S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (8-methoxy-6-oxobenzo[c]chromen-3-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
| SMILES | COc1ccc2c(c1)c(=O)oc1cc(OC(=O)C(NS(=O)(=O)c3ccc(C)cc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C29H23NO7S/c1-18-8-12-22(13-9-18)38(33,34)30-27(19-6-4-3-5-7-19)29(32)36-21-11-15-24-23-14-10-20(35-2)16-25(23)28(31)37-26(24)17-21/h3-17,27,30H,1-2H3 |
| InChIKey | XCVYYALJYGXCAE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|