C26H23NO6S — CID 3695513
(2-oxo-4-phenylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 3695513) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is (2-oxo-4-phenylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | (2-oxo-4-phenylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 3695513 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (2-oxo-4-phenylchromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H23NO6S/c1-3-23(27-34(30,31)20-12-9-17(2)10-13-20)26(29)32-19-11-14-21-22(18-7-5-4-6-8-18)16-25(28)33-24(21)15-19/h4-16,23,27H,3H2,1-2H3 |
| InChIKey | YAFZCMWIBLGFSP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|