C22H23NO6S — CID 3726492
(2-oxochromen-7-yl) 4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 3726492) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | (2-oxochromen-7-yl) 4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 3726492 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (2-oxochromen-7-yl) 4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(C)C)C(=O)Oc2ccc3ccc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C22H23NO6S/c1-14(2)12-19(23-30(26,27)18-9-4-15(3)5-10-18)22(25)28-17-8-6-16-7-11-21(24)29-20(16)13-17/h4-11,13-14,19,23H,12H2,1-3H3 |
| InChIKey | LTFVVXIONUKBKZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|