C22H25N3O4S2 — CID 155168817
[4-(2-amino-1,3-thiazol-4-yl)phenyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 155168817) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is [4-(2-amino-1,3-thiazol-4-yl)phenyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | [4-(2-amino-1,3-thiazol-4-yl)phenyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 155168817 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [4-(2-amino-1,3-thiazol-4-yl)phenyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)Oc2ccc(-c3csc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-14(2)12-19(25-31(27,28)18-10-4-15(3)5-11-18)21(26)29-17-8-6-16(7-9-17)20-13-30-22(23)24-20/h4-11,13-14,19,25H,12H2,1-3H3,(H2,23,24)/t19-/m0/s1 |
| InChIKey | CZGQOEBUMWVQRT-IBGZPJMESA-N |
| XLogP | 4.00 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|